C12H15F3N2O4 — CID 68608895
[3-hydroxy-3-[[3-(trifluoromethoxy)phenyl]methylamino]propyl]carbamic acid (PubChem CID 68608895) has the molecular formula C12H15F3N2O4 and a molecular weight of 308.26 g/mol. Its IUPAC name is [3-hydroxy-3-[[3-(trifluoromethoxy)phenyl]methylamino]propyl]carbamic acid.
| Compound Name | [3-hydroxy-3-[[3-(trifluoromethoxy)phenyl]methylamino]propyl]carbamic acid |
|---|---|
| PubChem CID | 68608895 |
| Molecular Formula | C12H15F3N2O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [3-hydroxy-3-[[3-(trifluoromethoxy)phenyl]methylamino]propyl]carbamic acid |
| SMILES | O=C(O)NCCC(O)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O4/c13-12(14,15)21-9-3-1-2-8(6-9)7-17-10(18)4-5-16-11(19)20/h1-3,6,10,16-18H,4-5,7H2,(H,19,20) |
| InChIKey | SOZJZFQMKUKLIV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|