C14H16F3NO3 — CID 106987927
2-[2-amino-5-(trifluoromethoxy)phenyl]-2-cyclopentylacetic acid (PubChem CID 106987927) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-[2-amino-5-(trifluoromethoxy)phenyl]-2-cyclopentylacetic acid.
| Compound Name | 2-[2-amino-5-(trifluoromethoxy)phenyl]-2-cyclopentylacetic acid |
|---|---|
| PubChem CID | 106987927 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[2-amino-5-(trifluoromethoxy)phenyl]-2-cyclopentylacetic acid |
| SMILES | Nc1ccc(OC(F)(F)F)cc1C(C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C14H16F3NO3/c15-14(16,17)21-9-5-6-11(18)10(7-9)12(13(19)20)8-3-1-2-4-8/h5-8,12H,1-4,18H2,(H,19,20) |
| InChIKey | DJZZBSSQGBFXKM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|