C16H22ClNO2 — CID 106987726
2-(2-amino-5-chlorophenyl)-2-(4,4-dimethylcyclohexyl)acetic acid (PubChem CID 106987726) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-(2-amino-5-chlorophenyl)-2-(4,4-dimethylcyclohexyl)acetic acid.
| Compound Name | 2-(2-amino-5-chlorophenyl)-2-(4,4-dimethylcyclohexyl)acetic acid |
|---|---|
| PubChem CID | 106987726 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-(2-amino-5-chlorophenyl)-2-(4,4-dimethylcyclohexyl)acetic acid |
| SMILES | CC1(C)CCC(C(C(=O)O)c2cc(Cl)ccc2N)CC1 |
| InChI | InChI=1S/C16H22ClNO2/c1-16(2)7-5-10(6-8-16)14(15(19)20)12-9-11(17)3-4-13(12)18/h3-4,9-10,14H,5-8,18H2,1-2H3,(H,19,20) |
| InChIKey | ATZKRNKFUMXOHC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|