C15H18ClNO2 — CID 106987790
2-(2-amino-5-chlorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetic acid (PubChem CID 106987790) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-(2-amino-5-chlorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetic acid.
| Compound Name | 2-(2-amino-5-chlorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetic acid |
|---|---|
| PubChem CID | 106987790 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(2-amino-5-chlorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetic acid |
| SMILES | Nc1ccc(Cl)cc1C(C(=O)O)C1CC2CCC1C2 |
| InChI | InChI=1S/C15H18ClNO2/c16-10-3-4-13(17)12(7-10)14(15(18)19)11-6-8-1-2-9(11)5-8/h3-4,7-9,11,14H,1-2,5-6,17H2,(H,18,19) |
| InChIKey | AXIWUCBYZMCYCV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|