C14H18ClNS — CID 79551804
2-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)-4-chloroaniline (PubChem CID 79551804) has the molecular formula C14H18ClNS and a molecular weight of 267.82 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)-4-chloroaniline.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)-4-chloroaniline |
|---|---|
| PubChem CID | 79551804 |
| Molecular Formula | C14H18ClNS |
| Molecular Weight | 267.82 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)-4-chloroaniline |
| SMILES | Nc1ccc(Cl)cc1SCC1CC2CCC1C2 |
| InChI | InChI=1S/C14H18ClNS/c15-12-3-4-13(16)14(7-12)17-8-11-6-9-1-2-10(11)5-9/h3-4,7,9-11H,1-2,5-6,8,16H2 |
| InChIKey | YTFXXLMMFVRTPO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|