C15H17BrCl2 — CID 63444757
2-[2-bromo-2-(2,5-dichlorophenyl)ethyl]bicyclo[2.2.1]heptane (PubChem CID 63444757) has the molecular formula C15H17BrCl2 and a molecular weight of 348.11 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,5-dichlorophenyl)ethyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[2-bromo-2-(2,5-dichlorophenyl)ethyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 63444757 |
| Molecular Formula | C15H17BrCl2 |
| Molecular Weight | 348.11 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 2-[2-bromo-2-(2,5-dichlorophenyl)ethyl]bicyclo[2.2.1]heptane |
| SMILES | Clc1ccc(Cl)c(C(Br)CC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C15H17BrCl2/c16-14(13-8-12(17)3-4-15(13)18)7-11-6-9-1-2-10(11)5-9/h3-4,8-11,14H,1-2,5-7H2 |
| InChIKey | HTMKAGGSCQZGKE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.11 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|