C17H23BrO — CID 55198185
2-[2-bromo-2-(4-methoxy-2-methylphenyl)ethyl]bicyclo[2.2.1]heptane (PubChem CID 55198185) has the molecular formula C17H23BrO and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-[2-bromo-2-(4-methoxy-2-methylphenyl)ethyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[2-bromo-2-(4-methoxy-2-methylphenyl)ethyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 55198185 |
| Molecular Formula | C17H23BrO |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-[2-bromo-2-(4-methoxy-2-methylphenyl)ethyl]bicyclo[2.2.1]heptane |
| SMILES | COc1ccc(C(Br)CC2CC3CCC2C3)c(C)c1 |
| InChI | InChI=1S/C17H23BrO/c1-11-7-15(19-2)5-6-16(11)17(18)10-14-9-12-3-4-13(14)8-12/h5-7,12-14,17H,3-4,8-10H2,1-2H3 |
| InChIKey | DELRHBMVUSWEOY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|