C17H24O2 — CID 106790580
2-(2-bicyclo[2.2.1]heptanyl)-1-(2-methoxy-4-methylphenyl)ethanol (PubChem CID 106790580) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-methoxy-4-methylphenyl)ethanol.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-methoxy-4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 106790580 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-methoxy-4-methylphenyl)ethanol |
| SMILES | COc1cc(C)ccc1C(O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C17H24O2/c1-11-3-6-15(17(7-11)19-2)16(18)10-14-9-12-4-5-13(14)8-12/h3,6-7,12-14,16,18H,4-5,8-10H2,1-2H3 |
| InChIKey | MRAIENPFWPISBO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |