C14H20OS — CID 102842439
2-(2-bicyclo[2.2.1]heptanyl)-1-(2-methylthiophen-3-yl)ethanol (PubChem CID 102842439) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-methylthiophen-3-yl)ethanol.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-methylthiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 102842439 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-methylthiophen-3-yl)ethanol |
| SMILES | Cc1sccc1C(O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C14H20OS/c1-9-13(4-5-16-9)14(15)8-12-7-10-2-3-11(12)6-10/h4-5,10-12,14-15H,2-3,6-8H2,1H3 |
| InChIKey | FPUFANAWNPOOQQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |