C16H21ClO2 — CID 115821259
2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloro-2-methoxyphenyl)ethanol (PubChem CID 115821259) has the molecular formula C16H21ClO2 and a molecular weight of 280.79 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloro-2-methoxyphenyl)ethanol.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloro-2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 115821259 |
| Molecular Formula | C16H21ClO2 |
| Molecular Weight | 280.79 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloro-2-methoxyphenyl)ethanol |
| SMILES | COc1cc(Cl)ccc1C(O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C16H21ClO2/c1-19-16-9-13(17)4-5-14(16)15(18)8-12-7-10-2-3-11(12)6-10/h4-5,9-12,15,18H,2-3,6-8H2,1H3 |
| InChIKey | JAUFOMTZHNRVBV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |