C11H16O2S — CID 102831550
1-(2-methylthiophen-3-yl)-2-(oxolan-3-yl)ethanol (PubChem CID 102831550) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 1-(2-methylthiophen-3-yl)-2-(oxolan-3-yl)ethanol.
| Compound Name | 1-(2-methylthiophen-3-yl)-2-(oxolan-3-yl)ethanol |
|---|---|
| PubChem CID | 102831550 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 1-(2-methylthiophen-3-yl)-2-(oxolan-3-yl)ethanol |
| SMILES | Cc1sccc1C(O)CC1CCOC1 |
| InChI | InChI=1S/C11H16O2S/c1-8-10(3-5-14-8)11(12)6-9-2-4-13-7-9/h3,5,9,11-12H,2,4,6-7H2,1H3 |
| InChIKey | PIRCURZUJOHZHD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |