C11H15ClO2S — CID 115789625
1-(3-chlorothiophen-2-yl)-2-(oxan-4-yl)ethanol (PubChem CID 115789625) has the molecular formula C11H15ClO2S and a molecular weight of 246.76 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-2-(oxan-4-yl)ethanol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-2-(oxan-4-yl)ethanol |
|---|---|
| PubChem CID | 115789625 |
| Molecular Formula | C11H15ClO2S |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-2-(oxan-4-yl)ethanol |
| SMILES | OC(CC1CCOCC1)c1sccc1Cl |
| InChI | InChI=1S/C11H15ClO2S/c12-9-3-6-15-11(9)10(13)7-8-1-4-14-5-2-8/h3,6,8,10,13H,1-2,4-5,7H2 |
| InChIKey | GAIOBMSGVNMHPZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |