C10H14ClNOS — CID 164650141
1-(3-chlorothiophen-2-yl)-2-pyrrolidin-3-ylethanol (PubChem CID 164650141) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-2-pyrrolidin-3-ylethanol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-2-pyrrolidin-3-ylethanol |
|---|---|
| PubChem CID | 164650141 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-2-pyrrolidin-3-ylethanol |
| SMILES | OC(CC1CCNC1)c1sccc1Cl |
| InChI | InChI=1S/C10H14ClNOS/c11-8-2-4-14-10(8)9(13)5-7-1-3-12-6-7/h2,4,7,9,12-13H,1,3,5-6H2 |
| InChIKey | YWVOYTILEUQQFM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |