C10H15Cl2NOS — CID 171247432
(R)-(3-chlorothiophen-2-yl)-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171247432) has the molecular formula C10H15Cl2NOS and a molecular weight of 268.21 g/mol. Its IUPAC name is (R)-(3-chlorothiophen-2-yl)-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (R)-(3-chlorothiophen-2-yl)-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171247432 |
| Molecular Formula | C10H15Cl2NOS |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (R)-(3-chlorothiophen-2-yl)-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1sccc1Cl)C1CCOCC1 |
| InChI | InChI=1S/C10H14ClNOS.ClH/c11-8-3-6-14-10(8)9(12)7-1-4-13-5-2-7;/h3,6-7,9H,1-2,4-5,12H2;1H/t9-;/m1./s1 |
| InChIKey | UHUXOTOKNCAZCC-SBSPUUFOSA-N |
| XLogP | 3.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |