C9H12ClNS — CID 80529926
(3-chlorothiophen-2-yl)-(2-methylcyclopropyl)methanamine (PubChem CID 80529926) has the molecular formula C9H12ClNS and a molecular weight of 201.72 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(2-methylcyclopropyl)methanamine.
| Compound Name | (3-chlorothiophen-2-yl)-(2-methylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 80529926 |
| Molecular Formula | C9H12ClNS |
| Molecular Weight | 201.72 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(2-methylcyclopropyl)methanamine |
| SMILES | CC1CC1C(N)c1sccc1Cl |
| InChI | InChI=1S/C9H12ClNS/c1-5-4-6(5)8(11)9-7(10)2-3-12-9/h2-3,5-6,8H,4,11H2,1H3 |
| InChIKey | CVADWNGNOTZZTI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |