C11H17ClN2S — CID 107362061
[(3-chlorothiophen-2-yl)-(3-methylcyclopentyl)methyl]hydrazine (PubChem CID 107362061) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is [(3-chlorothiophen-2-yl)-(3-methylcyclopentyl)methyl]hydrazine.
| Compound Name | [(3-chlorothiophen-2-yl)-(3-methylcyclopentyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107362061 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [(3-chlorothiophen-2-yl)-(3-methylcyclopentyl)methyl]hydrazine |
| SMILES | CC1CCC(C(NN)c2sccc2Cl)C1 |
| InChI | InChI=1S/C11H17ClN2S/c1-7-2-3-8(6-7)10(14-13)11-9(12)4-5-15-11/h4-5,7-8,10,14H,2-3,6,13H2,1H3 |
| InChIKey | AYGJBRMPBLIILK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|