C12H20N4 — CID 105233187
3-[hydrazinyl-(3-methylcyclopentyl)methyl]pyridin-2-amine (PubChem CID 105233187) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-[hydrazinyl-(3-methylcyclopentyl)methyl]pyridin-2-amine.
| Compound Name | 3-[hydrazinyl-(3-methylcyclopentyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105233187 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 3-[hydrazinyl-(3-methylcyclopentyl)methyl]pyridin-2-amine |
| SMILES | CC1CCC(C(NN)c2cccnc2N)C1 |
| InChI | InChI=1S/C12H20N4/c1-8-4-5-9(7-8)11(16-14)10-3-2-6-15-12(10)13/h2-3,6,8-9,11,16H,4-5,7,14H2,1H3,(H2,13,15) |
| InChIKey | DRCCXACNHRDPGE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|