C14H16N4 — CID 105224736
3-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(hydrazinyl)methyl]pyridin-2-amine (PubChem CID 105224736) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(hydrazinyl)methyl]pyridin-2-amine.
| Compound Name | 3-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(hydrazinyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105224736 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(hydrazinyl)methyl]pyridin-2-amine |
| SMILES | NNC(c1cccnc1N)C1Cc2ccccc21 |
| InChI | InChI=1S/C14H16N4/c15-14-11(6-3-7-17-14)13(18-16)12-8-9-4-1-2-5-10(9)12/h1-7,12-13,18H,8,16H2,(H2,15,17) |
| InChIKey | BDIIBEFGHCVPNM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|