C12H20N6 — CID 105249962
3-[1,4-diazabicyclo[2.2.2]octan-2-yl(hydrazinyl)methyl]pyridin-2-amine (PubChem CID 105249962) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-[1,4-diazabicyclo[2.2.2]octan-2-yl(hydrazinyl)methyl]pyridin-2-amine.
| Compound Name | 3-[1,4-diazabicyclo[2.2.2]octan-2-yl(hydrazinyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105249962 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3-[1,4-diazabicyclo[2.2.2]octan-2-yl(hydrazinyl)methyl]pyridin-2-amine |
| SMILES | NNC(c1cccnc1N)C1CN2CCN1CC2 |
| InChI | InChI=1S/C12H20N6/c13-12-9(2-1-3-15-12)11(16-14)10-8-17-4-6-18(10)7-5-17/h1-3,10-11,16H,4-8,14H2,(H2,13,15) |
| InChIKey | IWHLVLAEVVVLEN-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|