C13H17BrClFN4 — CID 106765337
[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine (PubChem CID 106765337) has the molecular formula C13H17BrClFN4 and a molecular weight of 363.66 g/mol. Its IUPAC name is [(4-bromo-3-chloro-2-fluorophenyl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine.
| Compound Name | [(4-bromo-3-chloro-2-fluorophenyl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106765337 |
| Molecular Formula | C13H17BrClFN4 |
| Molecular Weight | 363.66 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [(4-bromo-3-chloro-2-fluorophenyl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc(Br)c(Cl)c1F)C1CN2CCN1CC2 |
| InChI | InChI=1S/C13H17BrClFN4/c14-9-2-1-8(12(16)11(9)15)13(18-17)10-7-19-3-5-20(10)6-4-19/h1-2,10,13,18H,3-7,17H2 |
| InChIKey | ZWFQNNALLKHTCQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.66 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|