C15H20N4S — CID 105249896
[1-benzothiophen-7-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine (PubChem CID 105249896) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is [1-benzothiophen-7-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine.
| Compound Name | [1-benzothiophen-7-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249896 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [1-benzothiophen-7-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine |
| SMILES | NNC(c1cccc2ccsc12)C1CN2CCN1CC2 |
| InChI | InChI=1S/C15H20N4S/c16-17-14(13-10-18-5-7-19(13)8-6-18)12-3-1-2-11-4-9-20-15(11)12/h1-4,9,13-14,17H,5-8,10,16H2 |
| InChIKey | AULNZHFCSODYDR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|