C11H17BrN4O — CID 105250113
[(3-bromofuran-2-yl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine (PubChem CID 105250113) has the molecular formula C11H17BrN4O and a molecular weight of 301.19 g/mol. Its IUPAC name is [(3-bromofuran-2-yl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine.
| Compound Name | [(3-bromofuran-2-yl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105250113 |
| Molecular Formula | C11H17BrN4O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [(3-bromofuran-2-yl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine |
| SMILES | NNC(c1occc1Br)C1CN2CCN1CC2 |
| InChI | InChI=1S/C11H17BrN4O/c12-8-1-6-17-11(8)10(14-13)9-7-15-2-4-16(9)5-3-15/h1,6,9-10,14H,2-5,7,13H2 |
| InChIKey | PSFGXVHNGWCELR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 57.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|