C10H15BrN2OS2 — CID 105259746
[(3-bromofuran-2-yl)-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine (PubChem CID 105259746) has the molecular formula C10H15BrN2OS2 and a molecular weight of 323.28 g/mol. Its IUPAC name is [(3-bromofuran-2-yl)-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine.
| Compound Name | [(3-bromofuran-2-yl)-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105259746 |
| Molecular Formula | C10H15BrN2OS2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | [(3-bromofuran-2-yl)-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine |
| SMILES | CC1SCCSC1C(NN)c1occc1Br |
| InChI | InChI=1S/C10H15BrN2OS2/c1-6-10(16-5-4-15-6)8(13-12)9-7(11)2-3-14-9/h2-3,6,8,10,13H,4-5,12H2,1H3 |
| InChIKey | JMBATJJPFDRGJZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|