C12H19N3S2 — CID 105259619
[(3-methyl-1,4-dithian-2-yl)-(4-methyl-3-pyridinyl)methyl]hydrazine (PubChem CID 105259619) has the molecular formula C12H19N3S2 and a molecular weight of 269.44 g/mol. Its IUPAC name is [(3-methyl-1,4-dithian-2-yl)-(4-methyl-3-pyridinyl)methyl]hydrazine.
| Compound Name | [(3-methyl-1,4-dithian-2-yl)-(4-methyl-3-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105259619 |
| Molecular Formula | C12H19N3S2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [(3-methyl-1,4-dithian-2-yl)-(4-methyl-3-pyridinyl)methyl]hydrazine |
| SMILES | Cc1ccncc1C(NN)C1SCCSC1C |
| InChI | InChI=1S/C12H19N3S2/c1-8-3-4-14-7-10(8)11(15-13)12-9(2)16-5-6-17-12/h3-4,7,9,11-12,15H,5-6,13H2,1-2H3 |
| InChIKey | GSOJQTNFBMHFER-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|