C13H20N2S2 — CID 105259440
[(3-methyl-1,4-dithian-2-yl)-(2-methylphenyl)methyl]hydrazine (PubChem CID 105259440) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is [(3-methyl-1,4-dithian-2-yl)-(2-methylphenyl)methyl]hydrazine.
| Compound Name | [(3-methyl-1,4-dithian-2-yl)-(2-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105259440 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [(3-methyl-1,4-dithian-2-yl)-(2-methylphenyl)methyl]hydrazine |
| SMILES | Cc1ccccc1C(NN)C1SCCSC1C |
| InChI | InChI=1S/C13H20N2S2/c1-9-5-3-4-6-11(9)12(15-14)13-10(2)16-7-8-17-13/h3-6,10,12-13,15H,7-8,14H2,1-2H3 |
| InChIKey | ATHVWVXAVYOOAA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|