C10H18N4S2 — CID 105259576
[(3-methyl-1,4-dithian-2-yl)-(1-methylimidazol-2-yl)methyl]hydrazine (PubChem CID 105259576) has the molecular formula C10H18N4S2 and a molecular weight of 258.42 g/mol. Its IUPAC name is [(3-methyl-1,4-dithian-2-yl)-(1-methylimidazol-2-yl)methyl]hydrazine.
| Compound Name | [(3-methyl-1,4-dithian-2-yl)-(1-methylimidazol-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105259576 |
| Molecular Formula | C10H18N4S2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [(3-methyl-1,4-dithian-2-yl)-(1-methylimidazol-2-yl)methyl]hydrazine |
| SMILES | CC1SCCSC1C(NN)c1nccn1C |
| InChI | InChI=1S/C10H18N4S2/c1-7-9(16-6-5-15-7)8(13-11)10-12-3-4-14(10)2/h3-4,7-9,13H,5-6,11H2,1-2H3 |
| InChIKey | XFISAWKORKTNGM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|