C10H16N2S3 — CID 105259470
[(3-methyl-1,4-dithian-2-yl)-thiophen-3-ylmethyl]hydrazine (PubChem CID 105259470) has the molecular formula C10H16N2S3 and a molecular weight of 260.45 g/mol. Its IUPAC name is [(3-methyl-1,4-dithian-2-yl)-thiophen-3-ylmethyl]hydrazine.
| Compound Name | [(3-methyl-1,4-dithian-2-yl)-thiophen-3-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 105259470 |
| Molecular Formula | C10H16N2S3 |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | [(3-methyl-1,4-dithian-2-yl)-thiophen-3-ylmethyl]hydrazine |
| SMILES | CC1SCCSC1C(NN)c1ccsc1 |
| InChI | InChI=1S/C10H16N2S3/c1-7-10(15-5-4-14-7)9(12-11)8-2-3-13-6-8/h2-3,6-7,9-10,12H,4-5,11H2,1H3 |
| InChIKey | WQWCWHQGTJVQET-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|