C10H14F3N3S3 — CID 106786987
[(3-methyl-1,4-dithian-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine (PubChem CID 106786987) has the molecular formula C10H14F3N3S3 and a molecular weight of 329.44 g/mol. Its IUPAC name is [(3-methyl-1,4-dithian-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine.
| Compound Name | [(3-methyl-1,4-dithian-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
|---|---|
| PubChem CID | 106786987 |
| Molecular Formula | C10H14F3N3S3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | [(3-methyl-1,4-dithian-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
| SMILES | CC1SCCSC1C(NN)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H14F3N3S3/c1-5-8(18-3-2-17-5)7(16-14)6-4-15-9(19-6)10(11,12)13/h4-5,7-8,16H,2-3,14H2,1H3 |
| InChIKey | QFAKMDDYMWGJOP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|