C11H16F3N3S2 — CID 106787152
[2-(thian-4-yl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]hydrazine (PubChem CID 106787152) has the molecular formula C11H16F3N3S2 and a molecular weight of 311.40 g/mol. Its IUPAC name is [2-(thian-4-yl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]hydrazine.
| Compound Name | [2-(thian-4-yl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]hydrazine |
|---|---|
| PubChem CID | 106787152 |
| Molecular Formula | C11H16F3N3S2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | [2-(thian-4-yl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]hydrazine |
| SMILES | NNC(CC1CCSCC1)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C11H16F3N3S2/c12-11(13,14)10-16-6-9(19-10)8(17-15)5-7-1-3-18-4-2-7/h6-8,17H,1-5,15H2 |
| InChIKey | ZQSBFABRAJHCTP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|