C14H14F3N3S — CID 106786856
[2,3-dihydro-1H-inden-2-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine (PubChem CID 106786856) has the molecular formula C14H14F3N3S and a molecular weight of 313.35 g/mol. Its IUPAC name is [2,3-dihydro-1H-inden-2-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine.
| Compound Name | [2,3-dihydro-1H-inden-2-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
|---|---|
| PubChem CID | 106786856 |
| Molecular Formula | C14H14F3N3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [2,3-dihydro-1H-inden-2-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
| SMILES | NNC(c1cnc(C(F)(F)F)s1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H14F3N3S/c15-14(16,17)13-19-7-11(21-13)12(20-18)10-5-8-3-1-2-4-9(8)6-10/h1-4,7,10,12,20H,5-6,18H2 |
| InChIKey | QXFNASSFCJXAOS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|