C10H14F3N3O2S2 — CID 106787272
[(1,1-dioxothian-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine (PubChem CID 106787272) has the molecular formula C10H14F3N3O2S2 and a molecular weight of 329.37 g/mol. Its IUPAC name is [(1,1-dioxothian-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine.
| Compound Name | [(1,1-dioxothian-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
|---|---|
| PubChem CID | 106787272 |
| Molecular Formula | C10H14F3N3O2S2 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [(1,1-dioxothian-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
| SMILES | NNC(c1cnc(C(F)(F)F)s1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H14F3N3O2S2/c11-10(12,13)9-15-5-6(19-9)8(16-14)7-3-1-2-4-20(7,17)18/h5,7-8,16H,1-4,14H2 |
| InChIKey | CZHCPWUUFAJCBU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|