C12H16F3N3O2S — CID 102710467
[(1,1-dioxothian-2-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine (PubChem CID 102710467) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is [(1,1-dioxothian-2-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine.
| Compound Name | [(1,1-dioxothian-2-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine |
|---|---|
| PubChem CID | 102710467 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [(1,1-dioxothian-2-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine |
| SMILES | NNC(c1cnccc1C(F)(F)F)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H16F3N3O2S/c13-12(14,15)9-4-5-17-7-8(9)11(18-16)10-3-1-2-6-21(10,19)20/h4-5,7,10-11,18H,1-3,6,16H2 |
| InChIKey | RLAKVZOZEKTGNV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|