C11H14F3N3S — CID 102710391
[thiolan-2-yl-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine (PubChem CID 102710391) has the molecular formula C11H14F3N3S and a molecular weight of 277.31 g/mol. Its IUPAC name is [thiolan-2-yl-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine.
| Compound Name | [thiolan-2-yl-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine |
|---|---|
| PubChem CID | 102710391 |
| Molecular Formula | C11H14F3N3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | [thiolan-2-yl-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine |
| SMILES | NNC(c1cnccc1C(F)(F)F)C1CCCS1 |
| InChI | InChI=1S/C11H14F3N3S/c12-11(13,14)8-3-4-16-6-7(8)10(17-15)9-2-1-5-18-9/h3-4,6,9-10,17H,1-2,5,15H2 |
| InChIKey | VICZIMOJGKXQAI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|