C15H19N3S — CID 105255789
[isoquinolin-4-yl(thian-2-yl)methyl]hydrazine (PubChem CID 105255789) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is [isoquinolin-4-yl(thian-2-yl)methyl]hydrazine.
| Compound Name | [isoquinolin-4-yl(thian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105255789 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | [isoquinolin-4-yl(thian-2-yl)methyl]hydrazine |
| SMILES | NNC(c1cncc2ccccc12)C1CCCCS1 |
| InChI | InChI=1S/C15H19N3S/c16-18-15(14-7-3-4-8-19-14)13-10-17-9-11-5-1-2-6-12(11)13/h1-2,5-6,9-10,14-15,18H,3-4,7-8,16H2 |
| InChIKey | RULXUYOWRDAKCU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|