C13H15F3O3S — CID 115795998
(1,1-dioxothian-2-yl)-[2-(trifluoromethyl)phenyl]methanol (PubChem CID 115795998) has the molecular formula C13H15F3O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-[2-(trifluoromethyl)phenyl]methanol.
| Compound Name | (1,1-dioxothian-2-yl)-[2-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 115795998 |
| Molecular Formula | C13H15F3O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (1,1-dioxothian-2-yl)-[2-(trifluoromethyl)phenyl]methanol |
| SMILES | O=S1(=O)CCCCC1C(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3O3S/c14-13(15,16)10-6-2-1-5-9(10)12(17)11-7-3-4-8-20(11,18)19/h1-2,5-6,11-12,17H,3-4,7-8H2 |
| InChIKey | WGRHQYQWQQPSHT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |