C21H19F6NO2 — CID 3912326
1-[bis[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 3912326) has the molecular formula C21H19F6NO2 and a molecular weight of 431.38 g/mol. Its IUPAC name is 1-[bis[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[bis[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3912326 |
| Molecular Formula | C21H19F6NO2 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[bis[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccccc1C(F)(F)F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H19F6NO2/c22-20(23,24)15-9-3-1-7-13(15)18(28-12-6-5-11-17(28)19(29)30)14-8-2-4-10-16(14)21(25,26)27/h1-4,7-10,17-18H,5-6,11-12H2,(H,29,30) |
| InChIKey | ASKCGLAXWDKSNM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |