C19H17F4NO2 — CID 3628647
1-[(4-fluorophenyl)-[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 3628647) has the molecular formula C19H17F4NO2 and a molecular weight of 367.34 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)-[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(4-fluorophenyl)-[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3628647 |
| Molecular Formula | C19H17F4NO2 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-[(4-fluorophenyl)-[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(c1ccc(F)cc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H17F4NO2/c20-13-9-7-12(8-10-13)17(24-11-3-6-16(24)18(25)26)14-4-1-2-5-15(14)19(21,22)23/h1-2,4-5,7-10,16-17H,3,6,11H2,(H,25,26) |
| InChIKey | FZZYVXWNFUDKTF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |