C18H18F3NO3 — CID 4281079
1-[furan-2-yl-[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 4281079) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is 1-[furan-2-yl-[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[furan-2-yl-[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4281079 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-[furan-2-yl-[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccco1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H18F3NO3/c19-18(20,21)13-7-2-1-6-12(13)16(15-9-5-11-25-15)22-10-4-3-8-14(22)17(23)24/h1-2,5-7,9,11,14,16H,3-4,8,10H2,(H,23,24) |
| InChIKey | WUJSXGWVLAXIAL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |