C24H25NO4 — CID 3506386
1-[furan-2-yl-(4-phenylmethoxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 3506386) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-[furan-2-yl-(4-phenylmethoxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[furan-2-yl-(4-phenylmethoxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3506386 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[furan-2-yl-(4-phenylmethoxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccc(OCc2ccccc2)cc1)c1ccco1 |
| InChI | InChI=1S/C24H25NO4/c26-24(27)21-9-4-5-15-25(21)23(22-10-6-16-28-22)19-11-13-20(14-12-19)29-17-18-7-2-1-3-8-18/h1-3,6-8,10-14,16,21,23H,4-5,9,15,17H2,(H,26,27) |
| InChIKey | DOSQFQCSPRZNLC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |