C25H26N2O3 — CID 3911315
1-[(3-phenylmethoxyphenyl)-pyridin-2-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 3911315) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[(3-phenylmethoxyphenyl)-pyridin-2-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-phenylmethoxyphenyl)-pyridin-2-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3911315 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[(3-phenylmethoxyphenyl)-pyridin-2-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1cccc(OCc2ccccc2)c1)c1ccccn1 |
| InChI | InChI=1S/C25H26N2O3/c28-25(29)23-14-5-7-16-27(23)24(22-13-4-6-15-26-22)20-11-8-12-21(17-20)30-18-19-9-2-1-3-10-19/h1-4,6,8-13,15,17,23-24H,5,7,14,16,18H2,(H,28,29) |
| InChIKey | DACUBFUYEMRHJX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |