C24H31NO3 — CID 4588574
1-[1-(3-phenylmethoxyphenyl)pentyl]piperidine-2-carboxylic acid (PubChem CID 4588574) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[1-(3-phenylmethoxyphenyl)pentyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[1-(3-phenylmethoxyphenyl)pentyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4588574 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 1-[1-(3-phenylmethoxyphenyl)pentyl]piperidine-2-carboxylic acid |
| SMILES | CCCCC(c1cccc(OCc2ccccc2)c1)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C24H31NO3/c1-2-3-14-22(25-16-8-7-15-23(25)24(26)27)20-12-9-13-21(17-20)28-18-19-10-5-4-6-11-19/h4-6,9-13,17,22-23H,2-3,7-8,14-16,18H2,1H3,(H,26,27) |
| InChIKey | GAQJVGRWYBABDR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |