C17H23Cl2NO2 — CID 3949304
1-[1-(2,3-dichlorophenyl)pentyl]piperidine-2-carboxylic acid (PubChem CID 3949304) has the molecular formula C17H23Cl2NO2 and a molecular weight of 344.28 g/mol. Its IUPAC name is 1-[1-(2,3-dichlorophenyl)pentyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[1-(2,3-dichlorophenyl)pentyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3949304 |
| Molecular Formula | C17H23Cl2NO2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[1-(2,3-dichlorophenyl)pentyl]piperidine-2-carboxylic acid |
| SMILES | CCCCC(c1cccc(Cl)c1Cl)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C17H23Cl2NO2/c1-2-3-9-14(12-7-6-8-13(18)16(12)19)20-11-5-4-10-15(20)17(21)22/h6-8,14-15H,2-5,9-11H2,1H3,(H,21,22) |
| InChIKey | XLICFBXMXHYFRP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |