C19H29NO5 — CID 3970545
1-[1-(2,3,4-trimethoxyphenyl)pentyl]pyrrolidine-2-carboxylic acid (PubChem CID 3970545) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 1-[1-(2,3,4-trimethoxyphenyl)pentyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[1-(2,3,4-trimethoxyphenyl)pentyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3970545 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 1-[1-(2,3,4-trimethoxyphenyl)pentyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCC(c1ccc(OC)c(OC)c1OC)N1CCCC1C(=O)O |
| InChI | InChI=1S/C19H29NO5/c1-5-6-8-14(20-12-7-9-15(20)19(21)22)13-10-11-16(23-2)18(25-4)17(13)24-3/h10-11,14-15H,5-9,12H2,1-4H3,(H,21,22) |
| InChIKey | YKRVIXHNHBWKCC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |