1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid

C19H29NO4 — CID 3979028

IUPAC1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid
SMILESCCCCC(c1cccc(OC)c1OC)N1CCCC(C(=O)O)C1
InChIInChI=1S/C19H29NO4/c1-4-5-10-16(20-12-7-8-14(13-20)19(21)22)15-9-6-11-17(23-2)18(15)24-3/h6,9,11,14,16H,4-5,7-8,10,12-13H2,1-3H3,(H,21,22)
InChIKeyRCCJZUAYAPFHRI-UHFFFAOYSA-N
MW335.44 g/mol
LogP3.73
Rot. Bonds8

About 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid

1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid (PubChem CID 3979028) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid
PubChem CID3979028
Molecular FormulaC19H29NO4
Molecular Weight335.44 g/mol
Exact Mass335.21
IUPAC Name1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid
SMILESCCCCC(c1cccc(OC)c1OC)N1CCCC(C(=O)O)C1
InChIInChI=1S/C19H29NO4/c1-4-5-10-16(20-12-7-8-14(13-20)19(21)22)15-9-6-11-17(23-2)18(15)24-3/h6,9,11,14,16H,4-5,7-8,10,12-13H2,1-3H3,(H,21,22)
InChIKeyRCCJZUAYAPFHRI-UHFFFAOYSA-N
XLogP3.73
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.44
LogP ≤ 53.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid?
The IUPAC name of 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid (CID 3979028) is 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid.
What is the SMILES notation for 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid?
The canonical SMILES for 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid is CCCCC(c1cccc(OC)c1OC)N1CCCC(C(=O)O)C1.
What is the InChIKey of 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid?
The InChIKey is RCCJZUAYAPFHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO4/c1-4-5-10-16(20-12-7-8-14(13-20)19(21)22)15-9-6-11-17(23-2)18(15)24-3/h6,9,11,14,16H,4-5,7-8,10,12-13H2,1-3H3,(H,21,22).
What are the key properties of 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid?
1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid has a molecular weight of 335.44 g/mol, XLogP of 3.73, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid is sourced from PubChem (CID 3979028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).