C19H29NO4 — CID 3979028
1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid (PubChem CID 3979028) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3979028 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1-[1-(2,3-dimethoxyphenyl)pentyl]piperidine-3-carboxylic acid |
| SMILES | CCCCC(c1cccc(OC)c1OC)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C19H29NO4/c1-4-5-10-16(20-12-7-8-14(13-20)19(21)22)15-9-6-11-17(23-2)18(15)24-3/h6,9,11,14,16H,4-5,7-8,10,12-13H2,1-3H3,(H,21,22) |
| InChIKey | RCCJZUAYAPFHRI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |