C18H24F3NO2 — CID 3680989
1-[1-[4-(trifluoromethyl)phenyl]pentyl]piperidine-2-carboxylic acid (PubChem CID 3680989) has the molecular formula C18H24F3NO2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[1-[4-(trifluoromethyl)phenyl]pentyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[1-[4-(trifluoromethyl)phenyl]pentyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3680989 |
| Molecular Formula | C18H24F3NO2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-[1-[4-(trifluoromethyl)phenyl]pentyl]piperidine-2-carboxylic acid |
| SMILES | CCCCC(c1ccc(C(F)(F)F)cc1)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C18H24F3NO2/c1-2-3-6-15(22-12-5-4-7-16(22)17(23)24)13-8-10-14(11-9-13)18(19,20)21/h8-11,15-16H,2-7,12H2,1H3,(H,23,24) |
| InChIKey | ZLJPFESACMSXDR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |