C20H19ClF3NO2 — CID 5040337
1-[(3-chlorophenyl)-[4-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 5040337) has the molecular formula C20H19ClF3NO2 and a molecular weight of 397.82 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-[4-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)-[4-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5040337 |
| Molecular Formula | C20H19ClF3NO2 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-[(3-chlorophenyl)-[4-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1ccc(C(F)(F)F)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19ClF3NO2/c21-16-5-3-4-14(12-16)18(25-11-2-1-6-17(25)19(26)27)13-7-9-15(10-8-13)20(22,23)24/h3-5,7-10,12,17-18H,1-2,6,11H2,(H,26,27) |
| InChIKey | JVHFTXBDQFNBFT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |