C20H22ClNO2 — CID 5023473
1-[(3-chlorophenyl)-(4-methylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 5023473) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-(4-methylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)-(4-methylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5023473 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-[(3-chlorophenyl)-(4-methylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1ccc(C(c2cccc(Cl)c2)N2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C20H22ClNO2/c1-14-8-10-15(11-9-14)19(16-5-4-6-17(21)13-16)22-12-3-2-7-18(22)20(23)24/h4-6,8-11,13,18-19H,2-3,7,12H2,1H3,(H,23,24) |
| InChIKey | ZXURPTAJZULTPG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |