C18H17ClFNO2 — CID 3631454
1-[(4-chlorophenyl)-(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 3631454) has the molecular formula C18H17ClFNO2 and a molecular weight of 333.79 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(4-chlorophenyl)-(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3631454 |
| Molecular Formula | C18H17ClFNO2 |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-[(4-chlorophenyl)-(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(c1ccc(Cl)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H17ClFNO2/c19-14-8-6-12(7-9-14)17(13-3-1-4-15(20)11-13)21-10-2-5-16(21)18(22)23/h1,3-4,6-9,11,16-17H,2,5,10H2,(H,22,23) |
| InChIKey | GOHCLGADNRUYSA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |