C18H17Cl2NO2 — CID 4650052
1-[bis(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 4650052) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is 1-[bis(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[bis(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4650052 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 1-[bis(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO2/c19-14-6-1-4-12(10-14)17(13-5-2-7-15(20)11-13)21-9-3-8-16(21)18(22)23/h1-2,4-7,10-11,16-17H,3,8-9H2,(H,22,23) |
| InChIKey | MWXFCYGIMXDZSW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |