C21H19ClN2O2 — CID 3945511
1-[(3-chlorophenyl)-isoquinolin-6-ylmethyl]pyrrolidine-2-carboxylic acid (PubChem CID 3945511) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-isoquinolin-6-ylmethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)-isoquinolin-6-ylmethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3945511 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[(3-chlorophenyl)-isoquinolin-6-ylmethyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(c1cccc(Cl)c1)c1ccc2cnccc2c1 |
| InChI | InChI=1S/C21H19ClN2O2/c22-18-4-1-3-15(12-18)20(24-10-2-5-19(24)21(25)26)16-6-7-17-13-23-9-8-14(17)11-16/h1,3-4,6-9,11-13,19-20H,2,5,10H2,(H,25,26) |
| InChIKey | CGXZPNAFPSYTRI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |